C14H16BF2NO4 — CID 169354927
2-[3-(difluoromethoxy)-5-isocyanatophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 169354927) has the molecular formula C14H16BF2NO4 and a molecular weight of 311.09 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-5-isocyanatophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(difluoromethoxy)-5-isocyanatophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 169354927 |
| Molecular Formula | C14H16BF2NO4 |
| Molecular Weight | 311.09 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-[3-(difluoromethoxy)-5-isocyanatophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(N=C=O)cc(OC(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C14H16BF2NO4/c1-13(2)14(3,4)22-15(21-13)9-5-10(18-8-19)7-11(6-9)20-12(16)17/h5-7,12H,1-4H3 |
| InChIKey | OLLQVQOPDVLEAC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.09 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|