C17H19BF2N2O4 — CID 131700011
2-[3-(difluoromethoxy)phenoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (PubChem CID 131700011) has the molecular formula C17H19BF2N2O4 and a molecular weight of 364.16 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)phenoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine.
| Compound Name | 2-[3-(difluoromethoxy)phenoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 131700011 |
| Molecular Formula | C17H19BF2N2O4 |
| Molecular Weight | 364.16 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[3-(difluoromethoxy)phenoxy]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| SMILES | CC1(C)OB(c2cnc(Oc3cccc(OC(F)F)c3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H19BF2N2O4/c1-16(2)17(3,4)26-18(25-16)11-9-21-15(22-10-11)24-13-7-5-6-12(8-13)23-14(19)20/h5-10,14H,1-4H3 |
| InChIKey | FTOWBJVCOQTEPL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|