C14H22BF3N2O3 — CID 170582114
ethane;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethoxy)pyrimidine (PubChem CID 170582114) has the molecular formula C14H22BF3N2O3 and a molecular weight of 334.15 g/mol. Its IUPAC name is ethane;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethoxy)pyrimidine.
| Compound Name | ethane;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethoxy)pyrimidine |
|---|---|
| PubChem CID | 170582114 |
| Molecular Formula | C14H22BF3N2O3 |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | ethane;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethoxy)pyrimidine |
| SMILES | CC.CC1(C)OB(c2cnc(OCC(F)(F)F)nc2)OC1(C)C |
| InChI | InChI=1S/C12H16BF3N2O3.C2H6/c1-10(2)11(3,4)21-13(20-10)8-5-17-9(18-6-8)19-7-12(14,15)16;1-2/h5-6H,7H2,1-4H3;1-2H3 |
| InChIKey | PCVBKRKGCMVMCD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|