C17H19BF3N3O3 — CID 162618456
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[3-(trifluoromethoxy)phenyl]pyrimidin-2-amine (PubChem CID 162618456) has the molecular formula C17H19BF3N3O3 and a molecular weight of 381.16 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[3-(trifluoromethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[3-(trifluoromethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 162618456 |
| Molecular Formula | C17H19BF3N3O3 |
| Molecular Weight | 381.16 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-N-[3-(trifluoromethoxy)phenyl]pyrimidin-2-amine |
| SMILES | CC1(C)OB(c2cnc(Nc3cccc(OC(F)(F)F)c3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H19BF3N3O3/c1-15(2)16(3,4)27-18(26-15)11-9-22-14(23-10-11)24-12-6-5-7-13(8-12)25-17(19,20)21/h5-10H,1-4H3,(H,22,23,24) |
| InChIKey | PLIJQSREVFRCMM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|