C16H17BF3NO3 — CID 121231754
8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethoxy)quinoline (PubChem CID 121231754) has the molecular formula C16H17BF3NO3 and a molecular weight of 339.12 g/mol. Its IUPAC name is 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethoxy)quinoline.
| Compound Name | 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethoxy)quinoline |
|---|---|
| PubChem CID | 121231754 |
| Molecular Formula | C16H17BF3NO3 |
| Molecular Weight | 339.12 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethoxy)quinoline |
| SMILES | CC1(C)OB(c2cc(OC(F)(F)F)cc3cccnc23)OC1(C)C |
| InChI | InChI=1S/C16H17BF3NO3/c1-14(2)15(3,4)24-17(23-14)12-9-11(22-16(18,19)20)8-10-6-5-7-21-13(10)12/h5-9H,1-4H3 |
| InChIKey | BWLFHJXPWKOLPP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.12 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|