C16H20BF2N5O3 — CID 172979158
(1Z)-2-amino-N-[3-(difluoromethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172979158) has the molecular formula C16H20BF2N5O3 and a molecular weight of 379.18 g/mol. Its IUPAC name is (1Z)-2-amino-N-[3-(difluoromethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[3-(difluoromethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979158 |
| Molecular Formula | C16H20BF2N5O3 |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (1Z)-2-amino-N-[3-(difluoromethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cc(OC(F)F)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H20BF2N5O3/c1-15(2)16(3,4)27-17(26-15)9-5-10(7-11(6-9)25-14(18)19)23-24-12(8-20)13(21)22/h5-7,14,23H,1-4H3,(H3,21,22)/b24-12+ |
| InChIKey | NGNVFRHDLHODCT-WYMPLXKRSA-N |
| XLogP | 1.81 |
| TPSA | 125.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|