C13H16BF2NO5 — CID 138753647
2-[3-(difluoromethoxy)-4-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 138753647) has the molecular formula C13H16BF2NO5 and a molecular weight of 315.08 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-4-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(difluoromethoxy)-4-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 138753647 |
| Molecular Formula | C13H16BF2NO5 |
| Molecular Weight | 315.08 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[3-(difluoromethoxy)-4-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc([N+](=O)[O-])c(OC(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C13H16BF2NO5/c1-12(2)13(3,4)22-14(21-12)8-5-6-9(17(18)19)10(7-8)20-11(15)16/h5-7,11H,1-4H3 |
| InChIKey | QRLZPAUIXFZKLJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.08 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|