C13H16F2N2O5 — CID 133459069
3-(difluoromethoxy)-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-4-nitroaniline (PubChem CID 133459069) has the molecular formula C13H16F2N2O5 and a molecular weight of 318.28 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-4-nitroaniline.
| Compound Name | 3-(difluoromethoxy)-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-4-nitroaniline |
|---|---|
| PubChem CID | 133459069 |
| Molecular Formula | C13H16F2N2O5 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-(difluoromethoxy)-N-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-4-nitroaniline |
| SMILES | CC1(CCNc2ccc([N+](=O)[O-])c(OC(F)F)c2)OCCO1 |
| InChI | InChI=1S/C13H16F2N2O5/c1-13(20-6-7-21-13)4-5-16-9-2-3-10(17(18)19)11(8-9)22-12(14)15/h2-3,8,12,16H,4-7H2,1H3 |
| InChIKey | WKYWQTMRGOXAOU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|