C17H16F2N2O4 — CID 133321069
3-(difluoromethoxy)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-nitroaniline (PubChem CID 133321069) has the molecular formula C17H16F2N2O4 and a molecular weight of 350.32 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-nitroaniline.
| Compound Name | 3-(difluoromethoxy)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-nitroaniline |
|---|---|
| PubChem CID | 133321069 |
| Molecular Formula | C17H16F2N2O4 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 3-(difluoromethoxy)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(NCC2CCOc3ccccc32)cc1OC(F)F |
| InChI | InChI=1S/C17H16F2N2O4/c18-17(19)25-16-9-12(5-6-14(16)21(22)23)20-10-11-7-8-24-15-4-2-1-3-13(11)15/h1-6,9,11,17,20H,7-8,10H2 |
| InChIKey | VCURDPUOULUCOF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|