C16H16FNO — CID 115756557
N-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-fluoroaniline (PubChem CID 115756557) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-fluoroaniline.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-fluoroaniline |
|---|---|
| PubChem CID | 115756557 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-fluoroaniline |
| SMILES | Fc1cccc(NCC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C16H16FNO/c17-13-4-3-5-14(10-13)18-11-12-8-9-19-16-7-2-1-6-15(12)16/h1-7,10,12,18H,8-9,11H2 |
| InChIKey | GZUWVBWNSWDNGZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |