C21H20N2O — CID 129186352
N-[[(4S)-7-phenyl-3,4-dihydro-2H-chromen-4-yl]methyl]pyridin-3-amine (PubChem CID 129186352) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[[(4S)-7-phenyl-3,4-dihydro-2H-chromen-4-yl]methyl]pyridin-3-amine.
| Compound Name | N-[[(4S)-7-phenyl-3,4-dihydro-2H-chromen-4-yl]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 129186352 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[[(4S)-7-phenyl-3,4-dihydro-2H-chromen-4-yl]methyl]pyridin-3-amine |
| SMILES | c1ccc(-c2ccc3c(c2)OCC[C@@H]3CNc2cccnc2)cc1 |
| InChI | InChI=1S/C21H20N2O/c1-2-5-16(6-3-1)17-8-9-20-18(10-12-24-21(20)13-17)14-23-19-7-4-11-22-15-19/h1-9,11,13,15,18,23H,10,12,14H2/t18-/m1/s1 |
| InChIKey | GAVDMIUQJFUXDP-GOSISDBHSA-N |
| XLogP | 4.73 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |