C16H16INO — CID 104768255
N-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-iodoaniline (PubChem CID 104768255) has the molecular formula C16H16INO and a molecular weight of 365.21 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-iodoaniline.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-iodoaniline |
|---|---|
| PubChem CID | 104768255 |
| Molecular Formula | C16H16INO |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-iodoaniline |
| SMILES | Ic1cccc(NCC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C16H16INO/c17-13-4-3-5-14(10-13)18-11-12-8-9-19-16-7-2-1-6-15(12)16/h1-7,10,12,18H,8-9,11H2 |
| InChIKey | GVUJIABJUPNLBF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|