C12H18N2O — CID 104768421
2-(3,4-dihydro-2H-chromen-4-ylmethyl)-1,1-dimethylhydrazine (PubChem CID 104768421) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-1,1-dimethylhydrazine.
| Compound Name | 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 104768421 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-1,1-dimethylhydrazine |
| SMILES | CN(C)NCC1CCOc2ccccc21 |
| InChI | InChI=1S/C12H18N2O/c1-14(2)13-9-10-7-8-15-12-6-4-3-5-11(10)12/h3-6,10,13H,7-9H2,1-2H3 |
| InChIKey | RSLCHGYREIKNDU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|