C16H15BrFNO — CID 107635746
2-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-5-fluoroaniline (PubChem CID 107635746) has the molecular formula C16H15BrFNO and a molecular weight of 336.20 g/mol. Its IUPAC name is 2-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-5-fluoroaniline.
| Compound Name | 2-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-5-fluoroaniline |
|---|---|
| PubChem CID | 107635746 |
| Molecular Formula | C16H15BrFNO |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-5-fluoroaniline |
| SMILES | Fc1ccc(Br)c(NCC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C16H15BrFNO/c17-14-6-5-12(18)9-15(14)19-10-11-7-8-20-16-4-2-1-3-13(11)16/h1-6,9,11,19H,7-8,10H2 |
| InChIKey | GXRHLZDGLXGAOI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |