C16H15FO2S — CID 104771979
4-[(4-fluorophenyl)sulfinylmethyl]-3,4-dihydro-2H-chromene (PubChem CID 104771979) has the molecular formula C16H15FO2S and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfinylmethyl]-3,4-dihydro-2H-chromene.
| Compound Name | 4-[(4-fluorophenyl)sulfinylmethyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 104771979 |
| Molecular Formula | C16H15FO2S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfinylmethyl]-3,4-dihydro-2H-chromene |
| SMILES | O=S(CC1CCOc2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FO2S/c17-13-5-7-14(8-6-13)20(18)11-12-9-10-19-16-4-2-1-3-15(12)16/h1-8,12H,9-11H2 |
| InChIKey | PBTFRZYGGZWFSC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |