C14H19NO2S — CID 113451582
3-(3,4-dihydro-2H-chromen-4-ylmethylsulfinylmethyl)azetidine (PubChem CID 113451582) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-4-ylmethylsulfinylmethyl)azetidine.
| Compound Name | 3-(3,4-dihydro-2H-chromen-4-ylmethylsulfinylmethyl)azetidine |
|---|---|
| PubChem CID | 113451582 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-4-ylmethylsulfinylmethyl)azetidine |
| SMILES | O=S(CC1CNC1)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C14H19NO2S/c16-18(9-11-7-15-8-11)10-12-5-6-17-14-4-2-1-3-13(12)14/h1-4,11-12,15H,5-10H2 |
| InChIKey | FZCKGKWLNWCAPW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |