C22H28FNO2 — CID 142283431
1-[2-(3,4-dihydro-2H-chromen-4-yl)ethyl]piperidine;4-fluorophenol (PubChem CID 142283431) has the molecular formula C22H28FNO2 and a molecular weight of 357.47 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-2H-chromen-4-yl)ethyl]piperidine;4-fluorophenol.
| Compound Name | 1-[2-(3,4-dihydro-2H-chromen-4-yl)ethyl]piperidine;4-fluorophenol |
|---|---|
| PubChem CID | 142283431 |
| Molecular Formula | C22H28FNO2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[2-(3,4-dihydro-2H-chromen-4-yl)ethyl]piperidine;4-fluorophenol |
| SMILES | Oc1ccc(F)cc1.c1ccc2c(c1)OCCC2CCN1CCCCC1 |
| InChI | InChI=1S/C16H23NO.C6H5FO/c1-4-10-17(11-5-1)12-8-14-9-13-18-16-7-3-2-6-15(14)16;7-5-1-3-6(8)4-2-5/h2-3,6-7,14H,1,4-5,8-13H2;1-4,8H |
| InChIKey | RYXFMKGPZFDLJV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |