C16H14F2N2O4 — CID 133428062
1-[3-(difluoromethoxy)-4-nitroanilino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 133428062) has the molecular formula C16H14F2N2O4 and a molecular weight of 336.29 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)-4-nitroanilino]-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-[3-(difluoromethoxy)-4-nitroanilino]-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 133428062 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-[3-(difluoromethoxy)-4-nitroanilino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | O=[N+]([O-])c1ccc(NC2CCc3c(O)cccc32)cc1OC(F)F |
| InChI | InChI=1S/C16H14F2N2O4/c17-16(18)24-15-8-9(4-7-13(15)20(22)23)19-12-6-5-11-10(12)2-1-3-14(11)21/h1-4,7-8,12,16,19,21H,5-6H2 |
| InChIKey | KDRYYHFSNJKQLJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|