C21H23N3O4 — CID 133361775
[5-[(4-methoxy-2,3-dihydro-1H-inden-1-yl)amino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone (PubChem CID 133361775) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is [5-[(4-methoxy-2,3-dihydro-1H-inden-1-yl)amino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-[(4-methoxy-2,3-dihydro-1H-inden-1-yl)amino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 133361775 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [5-[(4-methoxy-2,3-dihydro-1H-inden-1-yl)amino]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1cccc2c1CCC2Nc1ccc([N+](=O)[O-])c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-28-20-6-4-5-15-16(20)8-9-18(15)22-14-7-10-19(24(26)27)17(13-14)21(25)23-11-2-3-12-23/h4-7,10,13,18,22H,2-3,8-9,11-12H2,1H3 |
| InChIKey | MCQSSLMGRINKQL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|