C17H23N3O5 — CID 122050224
(2S)-4-methyl-2-[4-nitro-3-(pyrrolidine-1-carbonyl)anilino]pentanoic acid (PubChem CID 122050224) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is (2S)-4-methyl-2-[4-nitro-3-(pyrrolidine-1-carbonyl)anilino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[4-nitro-3-(pyrrolidine-1-carbonyl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 122050224 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (2S)-4-methyl-2-[4-nitro-3-(pyrrolidine-1-carbonyl)anilino]pentanoic acid |
| SMILES | CC(C)C[C@H](Nc1ccc([N+](=O)[O-])c(C(=O)N2CCCC2)c1)C(=O)O |
| InChI | InChI=1S/C17H23N3O5/c1-11(2)9-14(17(22)23)18-12-5-6-15(20(24)25)13(10-12)16(21)19-7-3-4-8-19/h5-6,10-11,14,18H,3-4,7-9H2,1-2H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | ZBOLLOZMSOIJGT-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|