C23H28N4O3 — CID 133439744
[2-nitro-5-[(2-piperidin-1-ylphenyl)methylamino]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 133439744) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is [2-nitro-5-[(2-piperidin-1-ylphenyl)methylamino]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-nitro-5-[(2-piperidin-1-ylphenyl)methylamino]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 133439744 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | [2-nitro-5-[(2-piperidin-1-ylphenyl)methylamino]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc(NCc2ccccc2N2CCCCC2)ccc1[N+](=O)[O-])N1CCCC1 |
| InChI | InChI=1S/C23H28N4O3/c28-23(26-14-6-7-15-26)20-16-19(10-11-22(20)27(29)30)24-17-18-8-2-3-9-21(18)25-12-4-1-5-13-25/h2-3,8-11,16,24H,1,4-7,12-15,17H2 |
| InChIKey | FREBWHTWNVIGDO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|