C13H16F2N2O4 — CID 133495377
trans-(1S,2S)-2-[3-(difluoromethoxy)-4-nitroanilino]cyclohexan-1-ol (PubChem CID 133495377) has the molecular formula C13H16F2N2O4 and a molecular weight of 302.28 g/mol. Its IUPAC name is trans-(1S,2S)-2-[3-(difluoromethoxy)-4-nitroanilino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[3-(difluoromethoxy)-4-nitroanilino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 133495377 |
| Molecular Formula | C13H16F2N2O4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | trans-(1S,2S)-2-[3-(difluoromethoxy)-4-nitroanilino]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2CCCC[C@@H]2O)cc1OC(F)F |
| InChI | InChI=1S/C13H16F2N2O4/c14-13(15)21-12-7-8(5-6-10(12)17(19)20)16-9-3-1-2-4-11(9)18/h5-7,9,11,13,16,18H,1-4H2/t9-,11-/m0/s1 |
| InChIKey | SLGFTSSIKWPZLN-ONGXEEELSA-N |
| XLogP | 2.91 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|