C21H27BF2O4 — CID 171814083
2-[3-(difluoromethoxy)-4-[(3Z)-5-methyl-2-methylidenehexa-3,5-dienoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171814083) has the molecular formula C21H27BF2O4 and a molecular weight of 392.25 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-4-[(3Z)-5-methyl-2-methylidenehexa-3,5-dienoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(difluoromethoxy)-4-[(3Z)-5-methyl-2-methylidenehexa-3,5-dienoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171814083 |
| Molecular Formula | C21H27BF2O4 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-[3-(difluoromethoxy)-4-[(3Z)-5-methyl-2-methylidenehexa-3,5-dienoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(C)/C=C\C(=C)COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1OC(F)F |
| InChI | InChI=1S/C21H27BF2O4/c1-14(2)8-9-15(3)13-25-17-11-10-16(12-18(17)26-19(23)24)22-27-20(4,5)21(6,7)28-22/h8-12,19H,1,3,13H2,2,4-7H3/b9-8- |
| InChIKey | QFWNQCJAHKQSRF-HJWRWDBZSA-N |
| XLogP | 4.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|