C13H14BF2NO3 — CID 169355488
2-(3,5-difluoro-4-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 169355488) has the molecular formula C13H14BF2NO3 and a molecular weight of 281.07 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3,5-difluoro-4-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 169355488 |
| Molecular Formula | C13H14BF2NO3 |
| Molecular Weight | 281.07 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(3,5-difluoro-4-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(F)c(N=C=O)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C13H14BF2NO3/c1-12(2)13(3,4)20-14(19-12)8-5-9(15)11(17-7-18)10(16)6-8/h5-6H,1-4H3 |
| InChIKey | STMLFUHAXRSXKS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.07 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|