C20H16BBrF4N2O2 — CID 68961005
4-bromo-2,6-difluorobenzonitrile;2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 68961005) has the molecular formula C20H16BBrF4N2O2 and a molecular weight of 483.07 g/mol. Its IUPAC name is 4-bromo-2,6-difluorobenzonitrile;2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 4-bromo-2,6-difluorobenzonitrile;2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 68961005 |
| Molecular Formula | C20H16BBrF4N2O2 |
| Molecular Weight | 483.07 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 4-bromo-2,6-difluorobenzonitrile;2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2cc(F)c(C#N)c(F)c2)OC1(C)C.N#Cc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H14BF2NO2.C7H2BrF2N/c1-12(2)13(3,4)19-14(18-12)8-5-10(15)9(7-17)11(16)6-8;8-4-1-6(9)5(3-11)7(10)2-4/h5-6H,1-4H3;1-2H |
| InChIKey | CYZPGHIKKLIWJA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.07 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|