C14H16BF2NO3 — CID 171469803
2-fluoro-6-(fluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 171469803) has the molecular formula C14H16BF2NO3 and a molecular weight of 295.09 g/mol. Its IUPAC name is 2-fluoro-6-(fluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 2-fluoro-6-(fluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 171469803 |
| Molecular Formula | C14H16BF2NO3 |
| Molecular Weight | 295.09 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-fluoro-6-(fluoromethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2cc(F)c(C#N)c(OCF)c2)OC1(C)C |
| InChI | InChI=1S/C14H16BF2NO3/c1-13(2)14(3,4)21-15(20-13)9-5-11(17)10(7-18)12(6-9)19-8-16/h5-6H,8H2,1-4H3 |
| InChIKey | GAMVOIMXALULEA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.09 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|