C16H22BNO3 — CID 140843217
2-ethyl-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 140843217) has the molecular formula C16H22BNO3 and a molecular weight of 287.17 g/mol. Its IUPAC name is 2-ethyl-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 2-ethyl-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 140843217 |
| Molecular Formula | C16H22BNO3 |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-ethyl-6-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CCc1cc(B2OC(C)(C)C(C)(C)O2)cc(OC)c1C#N |
| InChI | InChI=1S/C16H22BNO3/c1-7-11-8-12(9-14(19-6)13(11)10-18)17-20-15(2,3)16(4,5)21-17/h8-9H,7H2,1-6H3 |
| InChIKey | ZJANNUSYTURAJI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|