C15H17BF2N2O3 — CID 168523812
2-cyano-N-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (PubChem CID 168523812) has the molecular formula C15H17BF2N2O3 and a molecular weight of 322.12 g/mol. Its IUPAC name is 2-cyano-N-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 168523812 |
| Molecular Formula | C15H17BF2N2O3 |
| Molecular Weight | 322.12 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-cyano-N-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| SMILES | CC1(C)OB(c2cc(F)c(NC(=O)CC#N)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C15H17BF2N2O3/c1-14(2)15(3,4)23-16(22-14)9-7-10(17)13(11(18)8-9)20-12(21)5-6-19/h7-8H,5H2,1-4H3,(H,20,21) |
| InChIKey | SGSWXLYDOLYVQF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.12 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|