C22H26BN3O5 — CID 67052931
ethyl 3-[(2-cyanoacetyl)amino]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2-carboxylate (PubChem CID 67052931) has the molecular formula C22H26BN3O5 and a molecular weight of 423.28 g/mol. Its IUPAC name is ethyl 3-[(2-cyanoacetyl)amino]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2-carboxylate.
| Compound Name | ethyl 3-[(2-cyanoacetyl)amino]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 67052931 |
| Molecular Formula | C22H26BN3O5 |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | ethyl 3-[(2-cyanoacetyl)amino]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CC#N)ccn1-c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C22H26BN3O5/c1-6-29-20(28)19-17(25-18(27)11-13-24)12-14-26(19)16-9-7-15(8-10-16)23-30-21(2,3)22(4,5)31-23/h7-10,12,14H,6,11H2,1-5H3,(H,25,27) |
| InChIKey | UGDBMTZGTXKKIS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|