C24H29BO4 — CID 155761122
ethyl 9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluorene-2-carboxylate (PubChem CID 155761122) has the molecular formula C24H29BO4 and a molecular weight of 392.30 g/mol. Its IUPAC name is ethyl 9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluorene-2-carboxylate.
| Compound Name | ethyl 9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluorene-2-carboxylate |
|---|---|
| PubChem CID | 155761122 |
| Molecular Formula | C24H29BO4 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | ethyl 9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluorene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)C(C)(C)c1cc(B3OC(C)(C)C(C)(C)O3)ccc1-2 |
| InChI | InChI=1S/C24H29BO4/c1-8-27-21(26)15-9-11-17-18-12-10-16(14-20(18)22(2,3)19(17)13-15)25-28-23(4,5)24(6,7)29-25/h9-14H,8H2,1-7H3 |
| InChIKey | GUWOWSKSSHDSQY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|