C27H36BNO4 — CID 59611294
2-[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxazolidine (PubChem CID 59611294) has the molecular formula C27H36BNO4 and a molecular weight of 449.40 g/mol. Its IUPAC name is 2-[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxazolidine.
| Compound Name | 2-[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxazolidine |
|---|---|
| PubChem CID | 59611294 |
| Molecular Formula | C27H36BNO4 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 2-[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxazolidine |
| SMILES | CC1(C)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(N3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C27H36BNO4/c1-23(2)21-15-17(28-30-24(3,4)25(5,6)31-28)11-13-19(21)20-14-12-18(16-22(20)23)29-32-26(7,8)27(9,10)33-29/h11-16H,1-10H3 |
| InChIKey | WRLMJIVFONQHAU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|