C48H46BN2O3P — CID 142351739
1,3-bis(9,9-dimethylfluoren-2-yl)-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide (PubChem CID 142351739) has the molecular formula C48H46BN2O3P and a molecular weight of 740.69 g/mol. Its IUPAC name is 1,3-bis(9,9-dimethylfluoren-2-yl)-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide.
| Compound Name | 1,3-bis(9,9-dimethylfluoren-2-yl)-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| PubChem CID | 142351739 |
| Molecular Formula | C48H46BN2O3P |
| Molecular Weight | 740.69 g/mol |
| Exact Mass | 740.33 |
| IUPAC Name | 1,3-bis(9,9-dimethylfluoren-2-yl)-2-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2λ5-benzodiazaphosphole 2-oxide |
| SMILES | CC1(C)c2ccccc2-c2ccc(N3c4ccc(B5OC(C)(C)C(C)(C)O5)cc4N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)P3(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C48H46BN2O3P/c1-45(2)39-20-14-12-18-35(39)37-25-23-32(29-41(37)45)50-43-27-22-31(49-53-47(5,6)48(7,8)54-49)28-44(43)51(55(50,52)34-16-10-9-11-17-34)33-24-26-38-36-19-13-15-21-40(36)46(3,4)42(38)30-33/h9-30H,1-8H3 |
| InChIKey | MAQDJANXARTVQS-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.69 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|