C39H32N3OP — CID 146263481
N-(9,9-dimethylfluoren-4-yl)-2-oxo-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphol-5-amine (PubChem CID 146263481) has the molecular formula C39H32N3OP and a molecular weight of 589.68 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-4-yl)-2-oxo-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphol-5-amine.
| Compound Name | N-(9,9-dimethylfluoren-4-yl)-2-oxo-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphol-5-amine |
|---|---|
| PubChem CID | 146263481 |
| Molecular Formula | C39H32N3OP |
| Molecular Weight | 589.68 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | N-(9,9-dimethylfluoren-4-yl)-2-oxo-1,2,3-triphenyl-1,3,2λ5-benzodiazaphosphol-5-amine |
| SMILES | CC1(C)c2ccccc2-c2c(Nc3ccc4c(c3)N(c3ccccc3)P(=O)(c3ccccc3)N4c3ccccc3)cccc21 |
| InChI | InChI=1S/C39H32N3OP/c1-39(2)33-22-13-12-21-32(33)38-34(39)23-14-24-35(38)40-28-25-26-36-37(27-28)42(30-17-8-4-9-18-30)44(43,31-19-10-5-11-20-31)41(36)29-15-6-3-7-16-29/h3-27,40H,1-2H3 |
| InChIKey | WGEGRKXQDOGNIE-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.68 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|