C33H28BrN2OP — CID 155236868
5-bromo-2-cyclohexa-1,5-dien-1-yl-1-(9,9-dimethylfluoren-4-yl)-3-phenyl-1,3,2λ5-benzodiazaphosphole 2-oxide (PubChem CID 155236868) has the molecular formula C33H28BrN2OP and a molecular weight of 579.48 g/mol. Its IUPAC name is 5-bromo-2-cyclohexa-1,5-dien-1-yl-1-(9,9-dimethylfluoren-4-yl)-3-phenyl-1,3,2λ5-benzodiazaphosphole 2-oxide.
| Compound Name | 5-bromo-2-cyclohexa-1,5-dien-1-yl-1-(9,9-dimethylfluoren-4-yl)-3-phenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| PubChem CID | 155236868 |
| Molecular Formula | C33H28BrN2OP |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | 5-bromo-2-cyclohexa-1,5-dien-1-yl-1-(9,9-dimethylfluoren-4-yl)-3-phenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
| SMILES | CC1(C)c2ccccc2-c2c(N3c4ccc(Br)cc4N(c4ccccc4)P3(=O)C3=CCCC=C3)cccc21 |
| InChI | InChI=1S/C33H28BrN2OP/c1-33(2)27-17-10-9-16-26(27)32-28(33)18-11-19-30(32)36-29-21-20-23(34)22-31(29)35(24-12-5-3-6-13-24)38(36,37)25-14-7-4-8-15-25/h3,5-7,9-22H,4,8H2,1-2H3 |
| InChIKey | FLUNGUHAZKWJFR-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|