C33H26BrN2OP — CID 134535975
5-bromo-1-(9,9-dimethylfluoren-1-yl)-2,3-diphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide (PubChem CID 134535975) has the molecular formula C33H26BrN2OP and a molecular weight of 577.46 g/mol. Its IUPAC name is 5-bromo-1-(9,9-dimethylfluoren-1-yl)-2,3-diphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide.
| Compound Name | 5-bromo-1-(9,9-dimethylfluoren-1-yl)-2,3-diphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
|---|---|
| PubChem CID | 134535975 |
| Molecular Formula | C33H26BrN2OP |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | 5-bromo-1-(9,9-dimethylfluoren-1-yl)-2,3-diphenyl-1,3,2λ5-benzodiazaphosphole 2-oxide |
| SMILES | CC1(C)c2ccccc2-c2cccc(N3c4ccc(Br)cc4N(c4ccccc4)P3(=O)c3ccccc3)c21 |
| InChI | InChI=1S/C33H26BrN2OP/c1-33(2)28-18-10-9-16-26(28)27-17-11-19-30(32(27)33)36-29-21-20-23(34)22-31(29)35(24-12-5-3-6-13-24)38(36,37)25-14-7-4-8-15-25/h3-22H,1-2H3 |
| InChIKey | DCZZPLYSBHYTHZ-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|