C30H33BN2O2 — CID 162768111
1-[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-2-ethylbenzimidazole (PubChem CID 162768111) has the molecular formula C30H33BN2O2 and a molecular weight of 464.42 g/mol. Its IUPAC name is 1-[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-2-ethylbenzimidazole.
| Compound Name | 1-[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-2-ethylbenzimidazole |
|---|---|
| PubChem CID | 162768111 |
| Molecular Formula | C30H33BN2O2 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 1-[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-2-ethylbenzimidazole |
| SMILES | CCc1nc2ccccc2n1-c1ccc2c(c1)C(C)(C)c1cc(B3OC(C)(C)C(C)(C)O3)ccc1-2 |
| InChI | InChI=1S/C30H33BN2O2/c1-8-27-32-25-11-9-10-12-26(25)33(27)20-14-16-22-21-15-13-19(17-23(21)28(2,3)24(22)18-20)31-34-29(4,5)30(6,7)35-31/h9-18H,8H2,1-7H3 |
| InChIKey | VSVKXFVVOVBOPX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|