C44H34N2O8 — CID 170242730
9-(9,9-dimethylfluoren-2-yl)-10-[4-(2-ethylbenzimidazol-1-yl)phenyl]anthracene-1,2,3,4,5,6,7,8-octol (PubChem CID 170242730) has the molecular formula C44H34N2O8 and a molecular weight of 718.76 g/mol. Its IUPAC name is 9-(9,9-dimethylfluoren-2-yl)-10-[4-(2-ethylbenzimidazol-1-yl)phenyl]anthracene-1,2,3,4,5,6,7,8-octol.
| Compound Name | 9-(9,9-dimethylfluoren-2-yl)-10-[4-(2-ethylbenzimidazol-1-yl)phenyl]anthracene-1,2,3,4,5,6,7,8-octol |
|---|---|
| PubChem CID | 170242730 |
| Molecular Formula | C44H34N2O8 |
| Molecular Weight | 718.76 g/mol |
| Exact Mass | 718.23 |
| IUPAC Name | 9-(9,9-dimethylfluoren-2-yl)-10-[4-(2-ethylbenzimidazol-1-yl)phenyl]anthracene-1,2,3,4,5,6,7,8-octol |
| SMILES | CCc1nc2ccccc2n1-c1ccc(-c2c3c(O)c(O)c(O)c(O)c3c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3c(O)c(O)c(O)c(O)c23)cc1 |
| InChI | InChI=1S/C44H34N2O8/c1-4-29-45-27-11-7-8-12-28(27)46(29)22-16-13-20(14-17-22)30-32-34(38(49)42(53)40(51)36(32)47)31(35-33(30)37(48)41(52)43(54)39(35)50)21-15-18-24-23-9-5-6-10-25(23)44(2,3)26(24)19-21/h5-19,47-54H,4H2,1-3H3 |
| InChIKey | DCSONHZKSXLVDJ-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 179.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.76 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|