C44H34N2 — CID 169072065
2-ethyl-1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]benzimidazole (PubChem CID 169072065) has the molecular formula C44H34N2 and a molecular weight of 598.82 g/mol. Its IUPAC name is 2-ethyl-1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]benzimidazole.
| Compound Name | 2-ethyl-1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 169072065 |
| Molecular Formula | C44H34N2 |
| Molecular Weight | 598.82 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | 2-ethyl-1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(9,9-dimethylfluoren-2-yl)anthracen-9-yl]phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc(-n4c(CC)nc5ccccc54)c3)c2c1[2H] |
| InChI | InChI=1S/C44H34N2/c1-4-41-45-39-22-11-12-23-40(39)46(41)30-15-13-14-28(26-30)42-33-17-5-7-19-35(33)43(36-20-8-6-18-34(36)42)29-24-25-32-31-16-9-10-21-37(31)44(2,3)38(32)27-29/h5-27H,4H2,1-3H3/i5D,6D,7D,8D,17D,18D,19D,20D |
| InChIKey | IBYCFUIIPJMZJH-LJHRBXIWSA-N |
| XLogP | 11.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.82 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|