C43H32N2 — CID 169072144
1-[4-[10-[9,9-bis(trideuteriomethyl)fluoren-2-yl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-methylbenzimidazole (PubChem CID 169072144) has the molecular formula C43H32N2 and a molecular weight of 590.83 g/mol. Its IUPAC name is 1-[4-[10-[9,9-bis(trideuteriomethyl)fluoren-2-yl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-methylbenzimidazole.
| Compound Name | 1-[4-[10-[9,9-bis(trideuteriomethyl)fluoren-2-yl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-methylbenzimidazole |
|---|---|
| PubChem CID | 169072144 |
| Molecular Formula | C43H32N2 |
| Molecular Weight | 590.83 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | 1-[4-[10-[9,9-bis(trideuteriomethyl)fluoren-2-yl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-methylbenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3ccc4c(c3)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])c3ccccc3-4)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-n4c(C)nc5ccccc54)cc3)c2c1[2H] |
| InChI | InChI=1S/C43H32N2/c1-27-44-39-18-10-11-19-40(39)45(27)30-23-20-28(21-24-30)41-33-13-4-6-15-35(33)42(36-16-7-5-14-34(36)41)29-22-25-32-31-12-8-9-17-37(31)43(2,3)38(32)26-29/h4-26H,1-3H3/i2D3,3D3,4D,5D,6D,7D,13D,14D,15D,16D |
| InChIKey | GOOHOPBNHAPOBP-OVLOWFPRSA-N |
| XLogP | 11.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.83 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|