C46H32N2 — CID 169071645
1-[4-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-methylbenzimidazole (PubChem CID 169071645) has the molecular formula C46H32N2 and a molecular weight of 630.89 g/mol. Its IUPAC name is 1-[4-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-methylbenzimidazole.
| Compound Name | 1-[4-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-methylbenzimidazole |
|---|---|
| PubChem CID | 169071645 |
| Molecular Formula | C46H32N2 |
| Molecular Weight | 630.89 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | 1-[4-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-methylbenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])cc(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4ccc(-n5c(C)nc6ccccc65)cc4)c4c([2H])c([2H])c([2H])c([2H])c34)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C46H32N2/c1-31-47-43-22-12-13-23-44(43)48(31)38-26-24-34(25-27-38)45-39-18-8-10-20-41(39)46(42-21-11-9-19-40(42)45)37-29-35(32-14-4-2-5-15-32)28-36(30-37)33-16-6-3-7-17-33/h2-30H,1H3/i2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,14D,15D,16D,17D,18D,19D,20D,21D |
| InChIKey | OQYYVNCRVAIFCA-CKLMWXHSSA-N |
| XLogP | 12.31 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.89 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|