C39H26N2 — CID 169070140
2-(2,3,4,5,6-pentadeuteriophenyl)-1-[4-(10-phenylanthracen-9-yl)phenyl]benzimidazole (PubChem CID 169070140) has the molecular formula C39H26N2 and a molecular weight of 527.68 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-1-[4-(10-phenylanthracen-9-yl)phenyl]benzimidazole.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-1-[4-(10-phenylanthracen-9-yl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 169070140 |
| Molecular Formula | C39H26N2 |
| Molecular Weight | 527.68 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-1-[4-(10-phenylanthracen-9-yl)phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc3ccccc3n2-c2ccc(-c3c4ccccc4c(-c4ccccc4)c4ccccc34)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C39H26N2/c1-3-13-27(14-4-1)37-31-17-7-9-19-33(31)38(34-20-10-8-18-32(34)37)28-23-25-30(26-24-28)41-36-22-12-11-21-35(36)40-39(41)29-15-5-2-6-16-29/h1-26H/i2D,5D,6D,15D,16D |
| InChIKey | QCIDTBAAKYOHBZ-KLZHWEBPSA-N |
| XLogP | 10.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.68 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|