C45H28N2O — CID 169071265
1-[4-(10-dibenzofuran-1-ylanthracen-9-yl)phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole (PubChem CID 169071265) has the molecular formula C45H28N2O and a molecular weight of 617.76 g/mol. Its IUPAC name is 1-[4-(10-dibenzofuran-1-ylanthracen-9-yl)phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole.
| Compound Name | 1-[4-(10-dibenzofuran-1-ylanthracen-9-yl)phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
|---|---|
| PubChem CID | 169071265 |
| Molecular Formula | C45H28N2O |
| Molecular Weight | 617.76 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | 1-[4-(10-dibenzofuran-1-ylanthracen-9-yl)phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc3ccccc3n2-c2ccc(-c3c4ccccc4c(-c4cccc5oc6ccccc6c45)c4ccccc34)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H28N2O/c1-2-13-30(14-3-1)45-46-38-21-9-10-22-39(38)47(45)31-27-25-29(26-28-31)42-32-15-4-6-17-34(32)43(35-18-7-5-16-33(35)42)37-20-12-24-41-44(37)36-19-8-11-23-40(36)48-41/h1-28H/i1D,2D,3D,13D,14D |
| InChIKey | GWNPXYSQDGCKNF-NDWIIPQNSA-N |
| XLogP | 12.23 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.76 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|