C40H26N2O — CID 169071484
1-[10-dibenzofuran-1-yl-3-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole (PubChem CID 169071484) has the molecular formula C40H26N2O and a molecular weight of 558.71 g/mol. Its IUPAC name is 1-[10-dibenzofuran-1-yl-3-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole.
| Compound Name | 1-[10-dibenzofuran-1-yl-3-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole |
|---|---|
| PubChem CID | 169071484 |
| Molecular Formula | C40H26N2O |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 1-[10-dibenzofuran-1-yl-3-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-2-(trideuteriomethyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(-n4c(C([2H])([2H])[2H])nc5ccccc54)c4ccccc4c(-c4cccc5oc6ccccc6c45)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C40H26N2O/c1-25-41-34-18-8-9-19-35(34)42(25)40-29-15-6-5-14-28(29)38(33-24-27(22-23-30(33)40)26-12-3-2-4-13-26)32-17-11-21-37-39(32)31-16-7-10-20-36(31)43-37/h2-24H,1H3/i1D3,2D,3D,4D,12D,13D |
| InChIKey | UBYPMEZZNPALQU-VOBJCGQESA-N |
| XLogP | 10.87 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|