About CID 174120240
CID 174120240 (PubChem CID 174120240) has the molecular formula C46H25B5N2O
and a molecular weight of 675.78 g/mol.
Molecular Properties
| Compound Name | CID 174120240 |
| PubChem CID | 174120240 |
| Molecular Formula | C46H25B5N2O |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc3c(-c4ccccc4-n4c(C)nc5ccccc54)c4ccccc4c(-c4cccc5oc6ccccc6c45)c3c2)c([B])c1[B] |
| InChI | InChI=1S/C46H25B5N2O/c1-24-52-33-16-6-8-18-35(33)53(24)34-17-7-4-13-29(34)39-26-11-2-3-12-27(26)40(31-15-10-20-37-41(31)30-14-5-9-19-36(30)54-37)32-23-25(21-22-28(32)39)38-42(47)44(49)46(51)45(50)43(38)48/h2-23H,1H3 |
| InChIKey | PIQIUUSNJXDXFU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174120240 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174120240?
The IUPAC name of CID 174120240 (CID 174120240) is not available.
What is the SMILES notation for CID 174120240?
The canonical SMILES for CID 174120240 is [B]c1c([B])c([B])c(-c2ccc3c(-c4ccccc4-n4c(C)nc5ccccc54)c4ccccc4c(-c4cccc5oc6ccccc6c45)c3c2)c([B])c1[B].
What is the InChIKey of CID 174120240?
The InChIKey is PIQIUUSNJXDXFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H25B5N2O/c1-24-52-33-16-6-8-18-35(33)53(24)34-17-7-4-13-29(34)39-26-11-2-3-12-27(26)40(31-15-10-20-37-41(31)30-14-5-9-19-36(30)54-37)32-23-25(21-22-28(32)39)38-42(47)44(49)46(51)45(50)43(38)48/h2-23H,1H3.
What are the key properties of CID 174120240?
CID 174120240 has a molecular weight of 675.78 g/mol, XLogP of 6.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174120240 is sourced from PubChem (CID 174120240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).