C51H32N2O — CID 169070462
2-[2-[10-dibenzofuran-1-yl-3-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]-1-phenylbenzimidazole (PubChem CID 169070462) has the molecular formula C51H32N2O and a molecular weight of 693.86 g/mol. Its IUPAC name is 2-[2-[10-dibenzofuran-1-yl-3-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]-1-phenylbenzimidazole.
| Compound Name | 2-[2-[10-dibenzofuran-1-yl-3-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 169070462 |
| Molecular Formula | C51H32N2O |
| Molecular Weight | 693.86 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | 2-[2-[10-dibenzofuran-1-yl-3-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]-1-phenylbenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(-c4ccccc4-c4nc5ccccc5n4-c4ccccc4)c4ccccc4c(-c4cccc5oc6ccccc6c45)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H32N2O/c1-3-16-33(17-4-1)34-30-31-39-43(32-34)49(42-25-15-29-47-50(42)41-24-11-14-28-46(41)54-47)37-21-8-7-20-36(37)48(39)38-22-9-10-23-40(38)51-52-44-26-12-13-27-45(44)53(51)35-18-5-2-6-19-35/h1-32H/i1D,3D,4D,16D,17D |
| InChIKey | LQBWGBREFGZQRE-DQWZHVRJSA-N |
| XLogP | 13.90 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.86 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|