C46H32N2 — CID 169070456
2-methyl-1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]benzimidazole (PubChem CID 169070456) has the molecular formula C46H32N2 and a molecular weight of 620.82 g/mol. Its IUPAC name is 2-methyl-1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]benzimidazole.
| Compound Name | 2-methyl-1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 169070456 |
| Molecular Formula | C46H32N2 |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | 2-methyl-1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc(-n4c(C)nc5ccccc54)c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2c1[2H] |
| InChI | InChI=1S/C46H32N2/c1-31-47-43-25-12-13-26-44(43)48(31)38-20-14-19-34(30-38)45-39-21-8-10-23-41(39)46(42-24-11-9-22-40(42)45)37-28-35(32-15-4-2-5-16-32)27-36(29-37)33-17-6-3-7-18-33/h2-30H,1H3/i8D,9D,10D,11D,21D,22D,23D,24D |
| InChIKey | YHNCWWZNQRDGNZ-XECNBBOISA-N |
| XLogP | 12.31 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|