C38H26N2 — CID 169070166
1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]phenyl]-2-(trideuteriomethyl)benzimidazole (PubChem CID 169070166) has the molecular formula C38H26N2 and a molecular weight of 528.75 g/mol. Its IUPAC name is 1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]phenyl]-2-(trideuteriomethyl)benzimidazole.
| Compound Name | 1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]phenyl]-2-(trideuteriomethyl)benzimidazole |
|---|---|
| PubChem CID | 169070166 |
| Molecular Formula | C38H26N2 |
| Molecular Weight | 528.75 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | 1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]phenyl]-2-(trideuteriomethyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4cccc(-n5c(C([2H])([2H])[2H])nc6ccccc65)c4)c4c([2H])c([2H])c([2H])c([2H])c34)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C38H26N2/c1-25-39-35-19-8-9-20-36(35)40(25)30-14-10-13-28(24-30)37-31-15-4-6-17-33(31)38(34-18-7-5-16-32(34)37)29-22-21-26-11-2-3-12-27(26)23-29/h2-24H,1H3/i1D3,2D,3D,4D,5D,6D,7D,11D,12D,15D,16D,17D,18D,21D,22D,23D |
| InChIKey | CXFWEIYKCMDNGN-BKDJCAABSA-N |
| XLogP | 10.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.75 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|