C47H34N2 — CID 169071753
2-ethyl-1-[3-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3-phenylphenyl)anthracen-9-yl]phenyl]phenyl]benzimidazole (PubChem CID 169071753) has the molecular formula C47H34N2 and a molecular weight of 634.85 g/mol. Its IUPAC name is 2-ethyl-1-[3-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3-phenylphenyl)anthracen-9-yl]phenyl]phenyl]benzimidazole.
| Compound Name | 2-ethyl-1-[3-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3-phenylphenyl)anthracen-9-yl]phenyl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 169071753 |
| Molecular Formula | C47H34N2 |
| Molecular Weight | 634.85 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | 2-ethyl-1-[3-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3-phenylphenyl)anthracen-9-yl]phenyl]phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc(-c4cccc(-n5c(CC)nc6ccccc65)c4)c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc(-c4ccccc4)c3)c2c1[2H] |
| InChI | InChI=1S/C47H34N2/c1-2-45-48-43-27-10-11-28-44(43)49(45)38-22-14-19-35(31-38)34-18-13-21-37(30-34)47-41-25-8-6-23-39(41)46(40-24-7-9-26-42(40)47)36-20-12-17-33(29-36)32-15-4-3-5-16-32/h3-31H,2H2,1H3/i6D,7D,8D,9D,23D,24D,25D,26D |
| InChIKey | CVBCWMUIYQSIOV-UIIICJRWSA-N |
| XLogP | 12.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.85 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|