C51H34N2 — CID 169070222
1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole (PubChem CID 169070222) has the molecular formula C51H34N2 and a molecular weight of 687.93 g/mol. Its IUPAC name is 1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole.
| Compound Name | 1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
|---|---|
| PubChem CID | 169070222 |
| Molecular Formula | C51H34N2 |
| Molecular Weight | 687.93 g/mol |
| Exact Mass | 687.35 |
| IUPAC Name | 1-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]-2-(2,3,4,5,6-pentadeuteriophenyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc3ccccc3n2-c2cccc(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c4c([2H])c([2H])c([2H])c([2H])c34)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H34N2/c1-4-17-35(18-5-1)39-31-40(36-19-6-2-7-20-36)33-41(32-39)50-45-27-12-10-25-43(45)49(44-26-11-13-28-46(44)50)38-23-16-24-42(34-38)53-48-30-15-14-29-47(48)52-51(53)37-21-8-3-9-22-37/h1-34H/i3D,8D,9D,10D,11D,12D,13D,21D,22D,25D,26D,27D,28D |
| InChIKey | XTVSLHQWBFFKTQ-VLWMXRMWSA-N |
| XLogP | 13.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.93 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|