C45H30N2 — CID 169071913
2-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-phenylphenyl)anthracen-9-yl]phenyl]-1-phenylbenzimidazole (PubChem CID 169071913) has the molecular formula C45H30N2 and a molecular weight of 606.80 g/mol. Its IUPAC name is 2-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-phenylphenyl)anthracen-9-yl]phenyl]-1-phenylbenzimidazole.
| Compound Name | 2-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-phenylphenyl)anthracen-9-yl]phenyl]-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 169071913 |
| Molecular Formula | C45H30N2 |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | 2-[3-[1,2,3,4,5,6,7,8-octadeuterio-10-(4-phenylphenyl)anthracen-9-yl]phenyl]-1-phenylbenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc(-c4nc5ccccc5n4-c4ccccc4)c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4ccccc4)cc3)c2c1[2H] |
| InChI | InChI=1S/C45H30N2/c1-3-14-31(15-4-1)32-26-28-33(29-27-32)43-37-20-7-9-22-39(37)44(40-23-10-8-21-38(40)43)34-16-13-17-35(30-34)45-46-41-24-11-12-25-42(41)47(45)36-18-5-2-6-19-36/h1-30H/i7D,8D,9D,10D,20D,21D,22D,23D |
| InChIKey | XJOPHTUEEOHOEE-REHAHKLHSA-N |
| XLogP | 12.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|